CHE 24: Organic Chemistry I Name
Quiz 1
September 11, 1998
1. Use arrows to show the flow of electrons in the following reaction.
CH3OH + -NH2
CH3O- + NH3
2. Convert the following structural formula to a skeletal (line) drawing.
CH3CH2CH(CH2CH3)CH2CHBrCH(CH3)C(CH3)3
3. What hybridization and bond angles do you expect for the indicated atom in the structure shown?

4. Draw a resonance structure for the species shown below.
![]()
5. Determine the formal charge for the carbon indicated in the structure below.
