CHE 24: Organic Chemistry I Name

Quiz 1

September 11, 1998

1. Use arrows to show the flow of electrons in the following reaction.

CH3OH + -NH2 CH3O- + NH3

 

2. Convert the following structural formula to a skeletal (line) drawing.

CH3CH2CH(CH2CH3)CH2CHBrCH(CH3)C(CH3)3

 

 

 

3. What hybridization and bond angles do you expect for the indicated atom in the structure shown?

4. Draw a resonance structure for the species shown below.

 

 

5. Determine the formal charge for the carbon indicated in the structure below.